1,2-bis(2-pyridyl)ethylene


1,2-bis(2-pyridyl)ethylene
CAS:[1437-15-6]
Formula:C12H10N2; 182.22 g/mol
InChiKey:HKEOCEQLCZEBMK-UHFFFAOYSA-N
SMILES:c1ccc(C=Cc2ccccn2)nc1
Molecular structure of 1,2-bis(2-pyridyl)ethylene
Melting point:119 °C
Log10 partition octanol / water:2.11

Isomers

1-aminocarbazole
Molecular structure of 1-aminocarbazole
2-aminocarbazole
Molecular structure of 2-aminocarbazole
3-aminocarbazole
Molecular structure of 3-aminocarbazole
azobenzene
Molecular structure of azobenzene
cis-azobenzene
Molecular structure of cis-azobenzene
(2E)-2-benzyl-3-methyl-2-butenedinitrile
Molecular structure of (2E)-2-benzyl-3-methyl-2-butenedinitrile
(2Z)-2-benzyl-3-methyl-2-butenedinitrile
Molecular structure of (2Z)-2-benzyl-3-methyl-2-butenedinitrile
1,2-bis(2-pyridyl)ethylene
Molecular structure of 1,2-bis(2-pyridyl)ethylene
1,2-di(4-pyridyl)ethylene
Molecular structure of 1,2-di(4-pyridyl)ethylene
3-[(E)-2-phenylethenyl]pyridazine
Molecular structure of 3-[(E)-2-phenylethenyl]pyridazine