(Z)-3-methylglutaconic acid


(Z)-3-methylglutaconic acid
CAS:[15649-56-6]
Formula:C6H8O4; 144.13 g/mol
InChiKey:WKRBKYFIJPGYQC-RQOWECAXSA-N
SMILES:CC(CC(O)=O)=CC(O)=O
Molecular structure of (Z)-3-methylglutaconic acid
Melting point:149 °C

Isomers

cyclobutane-1,1-dicarboxylic acid
Molecular structure of cyclobutane-1,1-dicarboxylic acid
cis-cyclobutane-1,2-dicarboxylic acid
Molecular structure of cis-cyclobutane-1,2-dicarboxylic acid
trans-cyclobutane-1,2-dicarboxylic acid
Molecular structure of trans-cyclobutane-1,2-dicarboxylic acid
cis-cyclobutane-1,3-dicarboxylic acid
Molecular structure of cis-cyclobutane-1,3-dicarboxylic acid
trans-cyclobutane-1,3-dicarboxylic acid
Molecular structure of trans-cyclobutane-1,3-dicarboxylic acid
dimethyl (E)-butenedioate
Molecular structure of dimethyl (E)-butenedioate
dimethyl (2Z)-2-butenedioate
Molecular structure of dimethyl (2Z)-2-butenedioate
(E)-2,3-dimethylbut-2-enedioic acid
Molecular structure of (E)-2,3-dimethylbut-2-enedioic acid
2,2-dimethyl-1,3-dioxane-4,6-dione
Molecular structure of 2,2-dimethyl-1,3-dioxane-4,6-dione
(3R*,6R*)-3,6-dimethyl-1,4-dioxane-2,5-dione
Molecular structure of (3R*,6R*)-3,6-dimethyl-1,4-dioxane-2,5-dione
(3S)-cis-3,6-dimethyl-1,4-dioxane-2,5-dione
Molecular structure of (3S)-cis-3,6-dimethyl-1,4-dioxane-2,5-dione
3,6-dimethyl-1,4-dioxane-2,5-dione
Molecular structure of 3,6-dimethyl-1,4-dioxane-2,5-dione
5,5-dimethyl-1,3-dioxane-4,6-dione
Molecular structure of 5,5-dimethyl-1,3-dioxane-4,6-dione
(Z)-4-ethoxy-4-oxobut-2-enoic acid
Molecular structure of (Z)-4-ethoxy-4-oxobut-2-enoic acid
(E)-2-hexenedioic acid
Molecular structure of (E)-2-hexenedioic acid
(E)-hex-3-enedioic acid
Molecular structure of (E)-hex-3-enedioic acid
4-hydroxy-5-methyl-4-cyclopentene-1,3-dione monohydrate
Molecular structure of 4-hydroxy-5-methyl-4-cyclopentene-1,3-dione monohydrate
1-methoxycarbonylcyclopropane-1-carboxylic acid
Molecular structure of 1-methoxycarbonylcyclopropane-1-carboxylic acid
2-methyl-1,1-cyclopropanedicarboxylic acid
Molecular structure of 2-methyl-1,1-cyclopropanedicarboxylic acid
(E)-2-methylglutaconic acid
Molecular structure of (E)-2-methylglutaconic acid
(Z)-2-methylglutaconic acid
Molecular structure of (Z)-2-methylglutaconic acid
(E)-3-methylglutaconic acid
Molecular structure of (E)-3-methylglutaconic acid
(Z)-3-methylglutaconic acid
Molecular structure of (Z)-3-methylglutaconic acid
3-methyl-2-oxooxolane-3-carboxylic acid
Molecular structure of 3-methyl-2-oxooxolane-3-carboxylic acid
2-prop-2-enylpropanedioic acid
Molecular structure of 2-prop-2-enylpropanedioic acid