(E)-octadec-9-enoic acid


elaidic acid; (E)-octadec-9-enoic acid; trans-9-octadecenoic acid
Links:📖 PubMed,
📖Houben-Weyl, 2. Band (Elaidins√§ure); p. 269, 474, 771, 793, 806
CAS:[112-79-8]
Formula:C18H34O2; 282.47 g/mol
InChiKey:ZQPPMHVWECSIRJ-MDZDMXLPSA-N
SMILES:CCCCCCCC/C=C/CCCCCCCC(O)=O
Molecular structure of (E)-octadec-9-enoic acid
Melting point:43 °C
Boiling point:362 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:7.64

Isomers

(Z)-octadec-11-enoic acid
Molecular structure of (Z)-octadec-11-enoic acid
(E)-octadec-9-enoic acid
Molecular structure of (E)-octadec-9-enoic acid
(Z)-octadec-9-enoic acid
Molecular structure of (Z)-octadec-9-enoic acid
petroselinic acid
Molecular structure of petroselinic acid
tetradecyl 2-methylprop-2-enoate
Molecular structure of tetradecyl 2-methylprop-2-enoate
vaccenic acid
Molecular structure of vaccenic acid