(2-hydroxyphenyl)diphenylphosphine


(2-hydroxyphenyl)diphenylphosphine
CAS:[60254-10-6]
Formula:C18H15OP; 278.29 g/mol
InChiKey:HGHOYIFINVBZKO-UHFFFAOYSA-N
SMILES:Oc1ccccc1P(c2ccccc2)c3ccccc3
Molecular structure of (2-hydroxyphenyl)diphenylphosphine
Melting point:146 °C

Isomers

(2-hydroxyphenyl)diphenylphosphine
Molecular structure of (2-hydroxyphenyl)diphenylphosphine
triphenylphosphine oxide
Molecular structure of triphenylphosphine oxide