fluorescein


acid yellow 73; C.I. 45350:1; D&C yellow 7; 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one; 3',6'-dihydroxy-spiro[3H-isobenzofuran-1,9'-xanthen]-3-one; 3,6-dihydroxyxanthene-9-spiro-1'-3'H-isobenzofuran-3'-one; fluorescein
Links:🌍 Wikipedia, 📖 PubMed,
📖Houben-Weyl, 2. Band (Fluorescein); p. 195, 583, 719, 1041
MeSH:Contrast Media; Fluorescent Dyes; Indicators and Reagents; Luminescent Agents
CAS:[2321-07-5]
Formula:C20H12O5; 332.31 g/mol
InChiKey:GNBHRKFJIUUOQI-UHFFFAOYSA-N
SMILES:Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5ccccc45)c1
Molecular structure of fluorescein
Use:solvent dye
Colour:
Density:1.602 g/mL
Molar volume:207.4 mL/mol
Melting point:320 °C
1g dissolves in:
7.52g pyridine;    20,000.00g water