dipropyl sulfate


di-n-propyl sulfate; dipropyl sulfate; di-n-propyl sulphate; propyl sulfate; n-propyl sulphate
CAS:[598-05-0]
Formula:C6H14O4S; 182.24 g/mol
InChiKey:JYCKNDWZDXGNBW-UHFFFAOYSA-N
SMILES:CCCO[S](=O)(=O)OCCC
Molecular structure of dipropyl sulfate
Density:1.110 g/mL
Molar volume:164.2 mL/mol
Refractive index:1.413
Molecular refractive power:40.96 mL/mol
Surface tension:32.73 dyn/cm