bis(4-dimethylaminophenyl)methanone


4,4-bis(dimethylamino)benzophenone; 4,4'-bis(dimethylamino)benzophenone; 4,4'-bis(dimethylamino)benzophenone; bis(4-dimethylaminophenyl)methanone; Michler's ketone; p,p'-bis(dimethylamino)benzophenone; tetramethyl-p,p'-diamidobenzophenone
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Michlers Keton); p. 227, 231, 611, 623
CAS:[90-94-8]
Formula:C17H20N2O; 268.36 g/mol
InChiKey:VVBLNCFGVYUYGU-UHFFFAOYSA-N
SMILES:CN(C)c1ccc(cc1)C(=O)c2ccc(cc2)N(C)C
Molecular structure of bis(4-dimethylaminophenyl)methanone
Melting point:179 °C
Log10 partition octanol / water:3.87
1g dissolves in:
10.08g pyridine;    2,500.00g water

Isomers

bis(4-dimethylaminophenyl)methanone
Molecular structure of bis(4-dimethylaminophenyl)methanone
daimuron
Molecular structure of daimuron
1,1-diethyl-3,3-diphenylurea
Molecular structure of 1,1-diethyl-3,3-diphenylurea
1,3-diethyl-1,3-diphenylurea
Molecular structure of 1,3-diethyl-1,3-diphenylurea
remacemide
Molecular structure of remacemide