5-nitro-1,3-benzenedicarboxylic acid


5-nitro-1,3-benzenedicarboxylic acid; 5-nitrobenzene-1,3-dicarboxylic acid; sym-nitroisophthalic acid; 5-nitroisophthalic acid
Links:🕷 ChemSpider
CAS:[618-88-2]
Formula:C8H5NO6; 211.13 g/mol
InChiKey:NBDAHKQJXVLAID-UHFFFAOYSA-N
SMILES:OC(=O)c1cc(cc(c1)[N+]([O-])=O)C(O)=O
Molecular structure of 5-nitro-1,3-benzenedicarboxylic acid
Melting point:255 °C
1g dissolves in:
454.55g water

Isomers

2-nitro-1,3-benzenedicarboxylic acid
Molecular structure of 2-nitro-1,3-benzenedicarboxylic acid
2-nitrobenzene-1,4-dicarboxylic acid
Molecular structure of 2-nitrobenzene-1,4-dicarboxylic acid
4-nitro-1,3-benzenedicarboxylic acid
Molecular structure of 4-nitro-1,3-benzenedicarboxylic acid
5-nitro-1,3-benzenedicarboxylic acid
Molecular structure of 5-nitro-1,3-benzenedicarboxylic acid
3-nitrophthalic acid
Molecular structure of 3-nitrophthalic acid
4-nitrophthalic acid
Molecular structure of 4-nitrophthalic acid
2,3,4-pyridinetricarboxylic acid
Molecular structure of 2,3,4-pyridinetricarboxylic acid
2,4,6-pyridinetricarboxylic acid
Molecular structure of 2,4,6-pyridinetricarboxylic acid