2,3,3-trichloroprop-2-enoic acid


trichloroacrylic acid; 2,3,3-trichloro-2-propenoic acid; 2,3,3-trichloroprop-2-enoic acid
Links:📏 NIST, 🕷 ChemSpider
CAS:[2257-35-4]
Formula:C3HCl3O2; 175.40 g/mol
InChiKey:WMUBNWIGNSIRDH-UHFFFAOYSA-N
SMILES:OC(=O)C(Cl)=C(Cl)Cl
Molecular structure of 2,3,3-trichloroprop-2-enoic acid
Melting point:76 °C
Boiling point:222 °C
1g dissolves in:
0.21g water