2,3,4,5-tetrabromo-6-methylphenol


3,4,5,6-tetrabromo-2-cresol; 2,3,4,5-tetrabromo-6-methylphenol; 3,4,5,6-tetrabromo-2-methylphenol
CAS:[576-55-6]
Formula:C7H4Br4O; 423.72 g/mol
InChiKey:GGIDUULRWQOXLR-UHFFFAOYSA-N
SMILES:Cc1c(O)c(Br)c(Br)c(Br)c1Br
Molecular structure of 2,3,4,5-tetrabromo-6-methylphenol
Melting point:208 °C
Log10 partition octanol / water:5.70

Isomers

1,2,3,5-tetrabromo-4-methoxybenzene
Molecular structure of 1,2,3,5-tetrabromo-4-methoxybenzene
2,3,4,5-tetrabromo-6-methylphenol
Molecular structure of 2,3,4,5-tetrabromo-6-methylphenol