2,3,4,5,6-pentamethylphenol


pentamethylphenol; 2,3,4,5,6-pentamethylphenol
Links:🕷 ChemSpider, ⚗️ ChemSynthesis
CAS:[2819-86-5]
Formula:C11H16O; 164.25 g/mol
InChiKey:WALBTDFSFTVXII-UHFFFAOYSA-N
SMILES:Cc1c(C)c(C)c(O)c(C)c1C
Molecular structure of pentamethylphenol
Melting point:128 °C

Isomers

benzyl n-butyl ether
Molecular structure of benzyl n-butyl ether
butoxymethylbenzene
Molecular structure of butoxymethylbenzene
1-butoxy-2-methylbenzene
Molecular structure of 1-butoxy-2-methylbenzene
1-butoxy-3-methylbenzene
Molecular structure of 1-butoxy-3-methylbenzene
1-butoxy-4-methylbenzene
Molecular structure of 1-butoxy-4-methylbenzene
7-tert-butoxy-2,5-norbornadiene
Molecular structure of 7-tert-butoxy-2,5-norbornadiene
4-tert-butylbenzyl alcohol
Molecular structure of 4-tert-butylbenzyl alcohol
1-tert-butyl-4-methoxybenzene
Molecular structure of 1-tert-butyl-4-methoxybenzene
2-butyl-4-methylphenol
Molecular structure of 2-butyl-4-methylphenol
2-tert-butyl-4-methylphenol
Molecular structure of 2-tert-butyl-4-methylphenol
2-tert-butyl-5-methylphenol
Molecular structure of 2-tert-butyl-5-methylphenol
2-tert-butyl-6-methylphenol
Molecular structure of 2-tert-butyl-6-methylphenol
4-tert-butyl-2-methylphenol
Molecular structure of 4-tert-butyl-2-methylphenol
5-tert-butyl-2-methylphenol
Molecular structure of 5-tert-butyl-2-methylphenol
2,2-dimethyl-1-phenyl-1-propanol
Molecular structure of 2,2-dimethyl-1-phenyl-1-propanol
2,2-dimethyl-3-phenylpropan-1-ol
Molecular structure of 2,2-dimethyl-3-phenylpropan-1-ol
2-ethoxy-1,3,5-trimethylbenzene
Molecular structure of 2-ethoxy-1,3,5-trimethylbenzene
fenipentol
Molecular structure of fenipentol
p-isobutylbenzyl alcohol
Molecular structure of p-isobutylbenzyl alcohol
1-isopropyl-2-methoxy-4-methylbenzene
Molecular structure of 1-isopropyl-2-methoxy-4-methylbenzene
2-isopropyl-1-methoxy-4-methylbenzene
Molecular structure of 2-isopropyl-1-methoxy-4-methylbenzene
4-isopropyl-1-methyl-2-methoxybenzene
Molecular structure of 4-isopropyl-1-methyl-2-methoxybenzene
cis-jasmone
Molecular structure of cis-jasmone
2-mesitylethanol
Molecular structure of 2-mesitylethanol
2-(2-methylbutan-2-yl)phenol
Molecular structure of 2-(2-methylbutan-2-yl)phenol
3-methylbutoxybenzene
Molecular structure of 3-methylbutoxybenzene
6-methyl-2-butylphenol
Molecular structure of 6-methyl-2-butylphenol
2-methyl-5-isopropylbenzyl alcohol
Molecular structure of 2-methyl-5-isopropylbenzyl alcohol
3-methyl-2-[(2E)-pent-2-en-1-yl]cyclopent-2-en-1-one
Molecular structure of 3-methyl-2-[(2E)-pent-2-en-1-yl]cyclopent-2-en-1-one
2-methyl-3-phenylbutan-2-ol
Molecular structure of 2-methyl-3-phenylbutan-2-ol
2-methyl-4-phenylbutan-2-ol
Molecular structure of 2-methyl-4-phenylbutan-2-ol
pentamethylphenol
Molecular structure of pentamethylphenol
2-pentan-2-ylphenol
Molecular structure of 2-pentan-2-ylphenol
4-pentan-2-ylphenol
Molecular structure of 4-pentan-2-ylphenol
pentoxybenzene
Molecular structure of pentoxybenzene
2-pentylphenol
Molecular structure of 2-pentylphenol
4-pentylphenol
Molecular structure of 4-pentylphenol
4-tert-pentylphenol
Molecular structure of 4-tert-pentylphenol
1-phenyl-2-pentanol
Molecular structure of 1-phenyl-2-pentanol
3-phenyl-3-pentanol
Molecular structure of 3-phenyl-3-pentanol
5-phenyl-1-pentanol
Molecular structure of 5-phenyl-1-pentanol
2,3,5,6-tetramethylbenzyl alcohol
Molecular structure of 2,3,5,6-tetramethylbenzyl alcohol
1,8,8-trimethylbicyclo[3.2.1]oct-3-en-2-one
Molecular structure of 1,8,8-trimethylbicyclo[3.2.1]oct-3-en-2-one
1,7,7-trimethyl-3-methylenebicyclo[2.2.1]heptan-2-one
Molecular structure of 1,7,7-trimethyl-3-methylenebicyclo[2.2.1]heptan-2-one