2,3,4,5,6-pentafluorothiophenol


pentafluorothiophenol; 2,3,4,5,6-pentafluorothiophenol
Links:📖 PubMed
CAS:[771-62-0]
Formula:C6HF5S; 200.13 g/mol
InChiKey:UVAMFBJPMUMURT-UHFFFAOYSA-N
SMILES:Fc1c(F)c(F)c(S)c(F)c1F
Molecular structure of pentafluorothiophenol
Density:1.501 g/mL
Molar volume:133.3 mL/mol
Melting point:-24 °C
Boiling point:143 °C