2,3,4,5,6-pentafluorophenol


pentafluorophenol; 2,3,4,5,6-pentafluorophenol
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[771-61-9]
Formula:C6HF5O; 184.07 g/mol
InChiKey:XBNGYFFABRKICK-UHFFFAOYSA-N
SMILES:Oc1c(F)c(F)c(F)c(F)c1F
Molecular structure of pentafluorophenol
Density:1.752 g/mL
Molar volume:105.1 mL/mol
Refractive index:1.427
Molecular refractive power:26.99 mL/mol
Dipole moment:2.54 D
Melting point:34 °C
Boiling point:146 °C
Log10 partition octanol / water:3.23