2,3,4,5,6-pentachlorophenol


pentachlorophenol; 2,3,4,5,6-pentachlorophenol
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
MeSH:Environmental Pollutants; Enzyme Inhibitors; Herbicides; Insecticides; Noxae; Pesticides; Poisons
CAS:[87-86-5]
Formula:C6HCl5O; 266.34 g/mol
InChiKey:IZUPBVBPLAPZRR-UHFFFAOYSA-N
SMILES:Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl
Molecular structure of pentachlorophenol
Density:1.978 g/mL
Molar volume:134.6 mL/mol
Dipole moment:2.14 D
Melting point:189 °C
Boiling point:146 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:5.18