2,3,4,5,6-pentabromophenol


pentabromophenol; 2,3,4,5,6-pentabromophenol
Links:📖 PubMed
CAS:[608-71-9]
Formula:C6HBr5O; 488.59 g/mol
InChiKey:SVHOVVJFOWGYJO-UHFFFAOYSA-N
SMILES:Oc1c(Br)c(Br)c(Br)c(Br)c1Br
Molecular structure of pentabromophenol
Melting point:225 °C
Log10 partition octanol / water:5.69