2,2'-azodiphenol


2,2'-azobisphenol; 2,2'-azodiphenol; o-azophenol; 2,2'-dihydroxyazobenzene
Links:📖 PubMed
CAS:[2050-14-8]
Formula:C12H10N2O2; 214.22 g/mol
InChiKey:JFEVWPNAOCPRHQ-UHFFFAOYSA-N
SMILES:Oc2ccccc2(N=NC1=CC=CC=C1(O))
Molecular structure of 2,2'-dihydroxyazobenzene
Melting point:173 °C

Isomers

2-amino-3'-nitrobiphenyl
Molecular structure of 2-amino-3'-nitrobiphenyl
2-amino-4'-nitrobiphenyl
Molecular structure of 2-amino-4'-nitrobiphenyl
3-amino-2'-nitrobiphenyl
Molecular structure of 3-amino-2'-nitrobiphenyl
3-amino-3'-nitrobiphenyl
Molecular structure of 3-amino-3'-nitrobiphenyl
3-amino-4'-nitrobiphenyl
Molecular structure of 3-amino-4'-nitrobiphenyl
4-amino-2'-nitrobiphenyl
Molecular structure of 4-amino-2'-nitrobiphenyl
4-amino-3'-nitrobiphenyl
Molecular structure of 4-amino-3'-nitrobiphenyl
4-amino-4'-nitrobiphenyl
Molecular structure of 4-amino-4'-nitrobiphenyl
2,2'-dihydroxyazobenzene
Molecular structure of 2,2'-dihydroxyazobenzene
2,4-dihydroxyazobenzene
Molecular structure of 2,4-dihydroxyazobenzene
4,4'-dihydroxyazobenzene
Molecular structure of 4,4'-dihydroxyazobenzene
cis-4,4'-dihydroxyazobenzene
Molecular structure of cis-4,4'-dihydroxyazobenzene
p-hydroxyazoxybenzene
Molecular structure of p-hydroxyazoxybenzene
2-hydroxy-1,2-di(pyridin-4-yl)ethanone
Molecular structure of 2-hydroxy-1,2-di(pyridin-4-yl)ethanone
4-(4-nitrobenzyl)pyridine
Molecular structure of 4-(4-nitrobenzyl)pyridine
2-nitro-N-phenylaniline
Molecular structure of 2-nitro-N-phenylaniline
3-nitro-N-phenylaniline
Molecular structure of 3-nitro-N-phenylaniline
4-nitro-N-phenylaniline
Molecular structure of 4-nitro-N-phenylaniline
4-(2-nitrophenyl)aniline
Molecular structure of 4-(2-nitrophenyl)aniline