1-methyl-6-(2-methylpropanoyl)phenol


o-isobutyro-o-cresol; o'-isobutyro-o-cresol; 2-methyl-1-(2-hydroxy-3-methylphenyl)-1-propanone; 1-methyl-6-(2-methylpropanoyl)phenol
Formula:C11H14O2; 178.23 g/mol
InChiKey:NHFQQIGFLXMBRH-UHFFFAOYSA-N
SMILES:CC(C)C(=O)c1cccc(C)c1O
Molecular structure of 2-methyl-1-(2-hydroxy-3-methylphenyl)-1-propanone
Density:1.047 g/mL
Molar volume:170.3 mL/mol

Isomers

4-allyl-1,2-dimethoxybenzene
Molecular structure of 4-allyl-1,2-dimethoxybenzene
benzyl isobutyrate
Molecular structure of benzyl isobutyrate
4-benzyloxy-2-butanone
Molecular structure of 4-benzyloxy-2-butanone
cis-4-benzyloxy-2-buten-1-ol
Molecular structure of cis-4-benzyloxy-2-buten-1-ol
4-butoxybenzaldehyde
Molecular structure of 4-butoxybenzaldehyde
butyl benzoate
Molecular structure of butyl benzoate
2-tert-butylbenzoic acid
Molecular structure of 2-tert-butylbenzoic acid
3-tert-butylbenzoic acid
Molecular structure of 3-tert-butylbenzoic acid
4-butylbenzoic acid
Molecular structure of 4-butylbenzoic acid
4-tert-butylbenzoic acid
Molecular structure of 4-tert-butylbenzoic acid
3-tert-butyl-2-hydroxybenzaldehyde
Molecular structure of 3-tert-butyl-2-hydroxybenzaldehyde
5-tert-butyl-2-hydroxybenzaldehyde
Molecular structure of 5-tert-butyl-2-hydroxybenzaldehyde
4-(tert-butyloxy)benzaldehyde
Molecular structure of 4-(tert-butyloxy)benzaldehyde
1,2-dimethoxy-4-propenylbenzene
Molecular structure of 1,2-dimethoxy-4-propenylbenzene
[(E)-3,3-dimethoxyprop-1-enyl]benzene
Molecular structure of [(E)-3,3-dimethoxyprop-1-enyl]benzene
1-(2,6-dimethylphenoxy)acetone
Molecular structure of 1-(2,6-dimethylphenoxy)acetone
2-ethoxy-5-[(E)-prop-1-enyl]phenol
Molecular structure of 2-ethoxy-5-[(E)-prop-1-enyl]phenol
ethyl 2,4-dimethylbenzoate
Molecular structure of ethyl 2,4-dimethylbenzoate
ethyl 2,6-dimethylbenzoate
Molecular structure of ethyl 2,6-dimethylbenzoate
ethyl 3,5-dimethylbenzoate
Molecular structure of ethyl 3,5-dimethylbenzoate
ethyl (2-methylphenyl)acetate
Molecular structure of ethyl (2-methylphenyl)acetate
ethyl 2-(2-methylphenyl)acetate
Molecular structure of ethyl 2-(2-methylphenyl)acetate
ethyl 2-(3-methylphenyl)acetate
Molecular structure of ethyl 2-(3-methylphenyl)acetate
ethyl 2-(4-methylphenyl)acetate
Molecular structure of ethyl 2-(4-methylphenyl)acetate
ethyl 3-phenylpropanoate
Molecular structure of ethyl 3-phenylpropanoate
4-hydroxy-5-isopropyl-2-methylbenzaldehyde
Molecular structure of 4-hydroxy-5-isopropyl-2-methylbenzaldehyde
2-hydroxy-4-(2-methylpropyl)benzaldehyde
Molecular structure of 2-hydroxy-4-(2-methylpropyl)benzaldehyde
1-(4-hydroxyphenyl)pentan-1-one
Molecular structure of 1-(4-hydroxyphenyl)pentan-1-one
5-isopropyl-2-methoxybenzaldehyde
Molecular structure of 5-isopropyl-2-methoxybenzaldehyde
isopropyl phenylacetate
Molecular structure of isopropyl phenylacetate
2-isopropylphenyl acetate
Molecular structure of 2-isopropylphenyl acetate
4-isopropylphenylacetic acid
Molecular structure of 4-isopropylphenylacetic acid
4'-methoxybutyrophenone
Molecular structure of 4'-methoxybutyrophenone
1-methoxy-4-(2-methylpropanoyl)benzene
Molecular structure of 1-methoxy-4-(2-methylpropanoyl)benzene
1-methoxy-4-methyl-2-propionylbenzene
Molecular structure of 1-methoxy-4-methyl-2-propionylbenzene
1-(2-methoxyphenyl)-2-butanone
Molecular structure of 1-(2-methoxyphenyl)-2-butanone
4-(4-methoxyphenyl)-2-butanone
Molecular structure of 4-(4-methoxyphenyl)-2-butanone
1-(2-methoxyphenyl)-3-buten-1-ol
Molecular structure of 1-(2-methoxyphenyl)-3-buten-1-ol
3-(4-methoxyphenyl)-2-methylpropanal
Molecular structure of 3-(4-methoxyphenyl)-2-methylpropanal
2-methyl-1-(2-hydroxy-3-methylphenyl)-1-propanone
Molecular structure of 2-methyl-1-(2-hydroxy-3-methylphenyl)-1-propanone
2-methyl-1-(2-hydroxy-4-methylphenyl)-1-propanone
Molecular structure of 2-methyl-1-(2-hydroxy-4-methylphenyl)-1-propanone
2-methyl-1-(2-hydroxy-5-methylphenyl)-1-propanone
Molecular structure of 2-methyl-1-(2-hydroxy-5-methylphenyl)-1-propanone
methyl 2-phenylbutanoate
Molecular structure of methyl 2-phenylbutanoate
methyl 4-phenylbutanoate
Molecular structure of methyl 4-phenylbutanoate
3-methyl-2-phenylbutanoic acid
Molecular structure of 3-methyl-2-phenylbutanoic acid
3-methyl-3-phenylbutanoic acid
Molecular structure of 3-methyl-3-phenylbutanoic acid
4-(4-methylphenyl)butanoic acid
Molecular structure of 4-(4-methylphenyl)butanoic acid
4-methyl-4-phenyl-1,3-dioxane
Molecular structure of 4-methyl-4-phenyl-1,3-dioxane
2-methylphenyl 2-methylpropanoate
Molecular structure of 2-methylphenyl 2-methylpropanoate
2-methylpropyl benzoate
Molecular structure of 2-methylpropyl benzoate
8α-methyl-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione
Molecular structure of 8a-methyl-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione
(R)-(-)-8α-methyl-3,4,8,8α-tetrahydro-1,6(2H,7H)-naphthalenedione
Molecular structure of (R)-(-)-8a-methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenedione
8α-methyl-3,4,8,8α-tetrahydro-1,6(2~H,7~H)-naphthalenedione
Molecular structure of 8a-methyl-3,4,8,8a-tetrahydro-1,6(2H,7H)-naphthalenedione
2-phenylethyl propionate
Molecular structure of 2-phenylethyl propionate
phenylmethyl butanoate
Molecular structure of phenylmethyl butanoate
phenyl 3-methylbutanoate
Molecular structure of phenyl 3-methylbutanoate
phenyl pentanoate
Molecular structure of phenyl pentanoate
2-phenylpentanoic acid
Molecular structure of 2-phenylpentanoic acid
4-phenylpentanoic acid
Molecular structure of 4-phenylpentanoic acid
5-phenylpentanoic acid
Molecular structure of 5-phenylpentanoic acid
3-phenylpropyl acetate
Molecular structure of 3-phenylpropyl acetate
propyl phenylacetate
Molecular structure of propyl phenylacetate
tetrahydronaphthyl methyl peroxide
Molecular structure of tetrahydronaphthyl methyl peroxide
2,3,5,6-tetramethylbenzoic acid
Molecular structure of 2,3,5,6-tetramethylbenzoic acid
2-(2,4,6-trimethylphenyl)acetic acid
Molecular structure of 2-(2,4,6-trimethylphenyl)acetic acid