1,3,5-tribromo-2,4,6-trimethylbenzene


tribromomesitylene; 1,3,5-tribromo-2,4,6-trimethylbenzene
CAS:[608-72-0]
Formula:C9H9Br3; 356.88 g/mol
InChiKey:LTSSSVHTLGQZAQ-UHFFFAOYSA-N
SMILES:Cc1c(Br)c(C)c(Br)c(C)c1Br
Molecular structure of 1,3,5-tribromo-2,4,6-trimethylbenzene
Dipole moment:0.00 D
Melting point:224 °C

Isomers

tribromopseudocumene
Molecular structure of tribromopseudocumene
1,2,3-tribromo-4,5,6-trimethylbenzene
Molecular structure of 1,2,3-tribromo-4,5,6-trimethylbenzene
1,3,5-tribromo-2,4,6-trimethylbenzene
Molecular structure of 1,3,5-tribromo-2,4,6-trimethylbenzene
1,3,5-tris(bromomethyl)benzene
Molecular structure of 1,3,5-tris(bromomethyl)benzene