1,3,5-triacetoxybenzene


phloroglucine triacetate; phloroglucinol triacetate; 1,3,5-triacetoxybenzene
CAS:[2999-40-8]
Formula:C12H12O6; 252.22 g/mol
InChiKey:CLWKAMVDWLTMKD-UHFFFAOYSA-N
SMILES:CC(=O)Oc1cc(OC(C)=O)cc(OC(C)=O)c1
Molecular structure of 1,3,5-triacetoxybenzene
Dipole moment:2.40 D
Melting point:104 °C

Isomers

(acetyloxy)methyl 2-(acetyloxy)benzoate
Molecular structure of (acetyloxy)methyl 2-(acetyloxy)benzoate
1,2,3-triacetoxybenzene
Molecular structure of 1,2,3-triacetoxybenzene
1,2,4-triacetoxybenzene
Molecular structure of 1,2,4-triacetoxybenzene
1,3,5-triacetoxybenzene
Molecular structure of 1,3,5-triacetoxybenzene
trimethyl 1,2,4-benzenetricarboxylate
Molecular structure of trimethyl 1,2,4-benzenetricarboxylate
trimethyl 1,3,5-benzenetricarboxylate
Molecular structure of trimethyl 1,3,5-benzenetricarboxylate