1,3,5-tri-tert-butyl-2-nitrobenzene


1,3,5-tri-tert-butyl-2-nitrobenzene; 2,4,6-tri-tert-butylnitrobenzene; 2,4,6-tri-t-butylnitrobenzene
Links:📏 NIST
CAS:[4074-25-3]
Formula:C18H29NO2; 291.43 g/mol
InChiKey:IMDZOFHRUMJNQR-UHFFFAOYSA-N
SMILES:CC(C)(C)c1cc(c(c(c1)C(C)(C)C)[N+]([O-])=O)C(C)(C)C
Molecular structure of 1,3,5-tri-tert-butyl-2-nitrobenzene
Dipole moment:3.51 D

Isomers

exaprolol
Molecular structure of exaprolol
ketocaine
Molecular structure of ketocaine
penbutolol
Molecular structure of penbutolol
1,3,5-tri-tert-butyl-2-nitrobenzene
Molecular structure of 1,3,5-tri-tert-butyl-2-nitrobenzene