1,3,5,7-tetranitro-1,3,5,7-tetrazocane


HMX; octogen; 1,3,5,7-tetranitroperhydro-1,3,5,7-tetraazocine; tetranitro-tetraazacyclooctane; 1,3,5,7-tetranitro-1,3,5,7-tetrazocane
Links:🕷 ChemSpider, 📖 PubMed
CAS:[2691-41-0]
Formula:C4H8N8O8; 296.16 g/mol
InChiKey:UZGLIIJVICEWHF-UHFFFAOYSA-N
SMILES:[O-][N+](=O)N1CN(CN(CN(C1)[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O
Molecular structure of 1,3,5,7-tetranitro-1,3,5,7-tetrazocane
Density:1.890 g/mL
Molar volume:156.7 mL/mol
Dipole moment:4.67 D
Log10 partition octanol / water:0.16