1,2-diphenylethanone


benzyl phenyl ketone; deoxybenzoin; desoxybenzoin; 1,2-diphenylethanone; 2-phenylacetophenone; phenyl benzyl ketone
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[451-40-1]
Formula:C14H12O; 196.25 g/mol
InChiKey:OTKCEEWUXHVZQI-UHFFFAOYSA-N
SMILES:O=C(Cc1ccccc1)c2ccccc2
Molecular structure of 1,2-diphenylethanone
Density:1.200 g/mL
Molar volume:163.5 mL/mol
Dipole moment:2.77 D
Melting point:60 °C
Boiling point:320 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:3.18

Isomers

2-acetylbiphenyl
Molecular structure of 2-acetylbiphenyl
3-acetylbiphenyl
Molecular structure of 3-acetylbiphenyl
4-acetylbiphenyl
Molecular structure of 4-acetylbiphenyl
10,10α-dihydroanthracen-9(8αH)-one
Molecular structure of 10,10a-dihydroanthracen-9(8aH)-one
diphenylacetaldehyde
Molecular structure of diphenylacetaldehyde
1,2-diphenylethanone
Molecular structure of 1,2-diphenylethanone
(2R,3S)-2,3-diphenyloxirane
Molecular structure of (2R,3S)-2,3-diphenyloxirane
trans-2,3-diphenyloxirane
Molecular structure of trans-2,3-diphenyloxirane
9-fluorenylmethanol
Molecular structure of 9-fluorenylmethanol
2-methylbenzophenone
Molecular structure of 2-methylbenzophenone
3-methylbenzophenone
Molecular structure of 3-methylbenzophenone
4-methylbenzophenone
Molecular structure of 4-methylbenzophenone
3-(4-methylphenyl)benzaldehyde
Molecular structure of 3-(4-methylphenyl)benzaldehyde
4-(4-methylphenyl)benzaldehyde
Molecular structure of 4-(4-methylphenyl)benzaldehyde
[(E)-2-(phenoxy)ethenyl]benzene
Molecular structure of [(E)-2-(phenoxy)ethenyl]benzene
7-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-ol
Molecular structure of 7-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-ol
2-[(E)-2-phenylvinyl]phenol
Molecular structure of 2-[(E)-2-phenylvinyl]phenol