1,2-diphenylethane-1,2-dione


benzil; dibenzoyl; 1,2-diphenylethane-1,2-dione; diphenylglyoxal
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Benzil); p. 48, 212, 217, 333, 397, 430, 468, 602, 652, 1006
CAS:[134-81-6]
Formula:C14H10O2; 210.23 g/mol
InChiKey:WURBFLDFSFBTLW-UHFFFAOYSA-N
SMILES:O=C(c1ccccc1)C(=O)c2ccccc2
Molecular structure of 1,2-diphenylethane-1,2-dione
Density:1.521 g/mL
Molar volume:138.2 mL/mol
Dipole moment:3.71 D
Melting point:95 °C
Boiling point:347 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:3.38

Isomers

anthracene-9,10-diol
Molecular structure of anthracene-9,10-diol
anthracene endoperoxide
Molecular structure of anthracene endoperoxide
1,2-dihydroxyphenanthrene
Molecular structure of 1,2-dihydroxyphenanthrene
1,6-dihydroxyphenanthrene
Molecular structure of 1,6-dihydroxyphenanthrene
1,7-dihydroxyphenanthrene
Molecular structure of 1,7-dihydroxyphenanthrene
2,3-dihydroxyphenanthrene
Molecular structure of 2,3-dihydroxyphenanthrene
2,6-dihydroxyphenanthrene
Molecular structure of 2,6-dihydroxyphenanthrene
2,7-dihydroxyphenanthrene
Molecular structure of 2,7-dihydroxyphenanthrene
3,4-dihydroxyphenanthrene
Molecular structure of 3,4-dihydroxyphenanthrene
3,6-dihydroxyphenanthrene
Molecular structure of 3,6-dihydroxyphenanthrene
9,10-dihydroxyphenanthrene
Molecular structure of 9,10-dihydroxyphenanthrene
1,2-diphenylethane-1,2-dione
Molecular structure of 1,2-diphenylethane-1,2-dione
fluorene-1-carboxylic acid
Molecular structure of fluorene-1-carboxylic acid
fluorene-4-carboxylic acid
Molecular structure of fluorene-4-carboxylic acid
fluorene-9-carboxylic acid
Molecular structure of fluorene-9-carboxylic acid
10-hydroxy-10H-anthracen-9-one
Molecular structure of 10-hydroxy-10H-anthracen-9-one
3-phenyl-3H-2-benzofuran-1-one
Molecular structure of 3-phenyl-3H-2-benzofuran-1-one