(S)-(-)-2-[(1-hydroxy-3,3-dimethylbutan-2-ylimino)methyl]-4,6-diiodophenol


(S)-(-)-2-[(1-hydroxy-3,3-dimethylbutan-2-ylimino)methyl]-4,6-diiodophenol
CAS:[477339-39-2]
Formula:C13H17I2NO2; 473.09 g/mol
InChiKey:WVBNUUNXQNMMOB-LLVKDONJSA-N
SMILES:CC(C)(C)[C@@H](CO)N=Cc1cc(I)cc(I)c1O
Molecular structure of (S)-(-)-2-[(1-hydroxy-3,3-dimethylbutan-2-ylimino)methyl]-4,6-diiodophenol
Melting point:166 °C