(RS)-4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol


albuterol; (RS)-4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol; sambutamol
Links:📖 PubMed
MeSH:Adrenergic Agents; Anti-Asthmatic Agents; Autonomic Agents; Bronchodilator Agents; Neurotransmitter Agents
CAS:[18559-94-9]
Formula:C13H21NO3; 239.31 g/mol
InChiKey:NDAUXUAQIAJITI-UHFFFAOYSA-N
SMILES:[H]C(O)(c1ccc(O)c(c1)CO)CNC(C)(C)C
Molecular structure of albuterol
Melting point:151 °C

Isomers

albuterol
Molecular structure of albuterol
2-(3,5-dimethoxy-4-propan-2-yloxyphenyl)ethanamine
Molecular structure of 2-(3,5-dimethoxy-4-propan-2-yloxyphenyl)ethanamine
isoetharine
Molecular structure of isoetharine
moprolol
Molecular structure of moprolol
salbutamol
Molecular structure of salbutamol