(E)-4,4'-(1,2-diethyl-1,2-ethenediyl)bisphenol


DES; (E)-4,4'-(1,2-diethyl-1,2-ethenediyl)bisphenol; diethylstilbestrol; 4,4'-(3E)-hex-3-ene-3,4-diyldiphenol; 4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenol
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed
MeSH:Carcinogens; Estrogens; Hormones, Hormone Substitutes, and Hormone Antagonists; Noxae
CAS:[56-53-1]
Formula:C18H20O2; 268.36 g/mol
InChiKey:RGLYKWWBQGJZGM-ISLYRVAYSA-N
SMILES:CCC(c1ccc(O)cc1)=C(CC)/c2ccc(O)cc2
Molecular structure of diethylstilbestrol
Melting point:171 °C
Log10 partition octanol / water:5.07

Isomers

bisphenol Z
Molecular structure of bisphenol Z
(Z)-1,4-dibenzyloxy-2-butene
Molecular structure of (Z)-1,4-dibenzyloxy-2-butene
diethylstilbestrol
Molecular structure of diethylstilbestrol
equilin
Molecular structure of equilin
4-(2,2,4-trimethylchroman-4-yl)phenol
Molecular structure of 4-(2,2,4-trimethylchroman-4-yl)phenol