(4-chlorophenyl)-cyclopropylmethanone


p-chlorophenyl cyclopropyl ketone; 4-chlorophenyl cyclopropyl ketone; (4-chlorophenyl)-cyclopropylmethanone
Links:📏 NIST
CAS:[6640-25-1]
Formula:C10H9ClO; 180.63 g/mol
InChiKey:OPSFCTBBDIDFJM-UHFFFAOYSA-N
SMILES:Clc1ccc(cc1)C(=O)C2CC2
Molecular structure of (4-chlorophenyl)-cyclopropylmethanone
Density:1.160 g/mL
Molar volume:155.7 mL/mol
Refractive index:1.572
Molecular refractive power:51.22 mL/mol
Dipole moment:2.49 D
Melting point:30 °C

Isomers

6-chloro-3,4-dihydro-2(1~H)-naphthalenone
Molecular structure of 6-chloro-3,4-dihydro-2(1H)-naphthalenone
(E)-4-(4-chlorophenyl)-3-buten-2-one
Molecular structure of (E)-4-(4-chlorophenyl)-3-buten-2-one
(4-chlorophenyl)-cyclopropylmethanone
Molecular structure of (4-chlorophenyl)-cyclopropylmethanone