(4-bromophenyl)-cyclopropylmethanone


p-bromophenyl cyclopropyl ketone; (4-bromophenyl)-cyclopropylmethanone
Links:🕷 ChemSpider
Formula:C10H9BrO; 225.08 g/mol
InChiKey:QTHHOINSCNBYQO-UHFFFAOYSA-N
SMILES:Brc1ccc(cc1)C(=O)C2CC2
Molecular structure of (4-bromophenyl)-cyclopropylmethanone
Dipole moment:2.48 D

Isomers

7-bromo-3,4-dihydronaphthalen-1(2~H)-one
Molecular structure of 7-bromo-3,4-dihydronaphthalen-1(2H)-one
(4-bromophenyl)-cyclopropylmethanone
Molecular structure of (4-bromophenyl)-cyclopropylmethanone