dropropizine


dropropizine; 3-(4-phenylpiperazin-1-yl)propane-1,2-diol
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[17692-31-8]
Formula:C13H20N2O2; 236.31 g/mol
InChiKey:PTVWPYVOOKLBCG-UHFFFAOYSA-N
SMILES:OCC(O)CN1CCN(CC1)c2ccccc2
Molecular structure of dropropizine
Melting point:105 °C

Isomers

(2-amino-1-phenyl-ethyl)carbamic acid tert-butyl ester
Molecular structure of (2-amino-1-phenyl-ethyl)carbamic acid tert-butyl ester
1-(N-Boc-aminomethyl)-3-(aminomethyl)benzene
Molecular structure of 1-(N-Boc-aminomethyl)-3-(aminomethyl)benzene
2-(butylamino)ethyl 4-aminobenzoate
Molecular structure of 2-(butylamino)ethyl 4-aminobenzoate
tert-butyl N-[[4-(aminomethyl)phenyl]methyl]carbamate
Molecular structure of tert-butyl N-[[4-(aminomethyl)phenyl]methyl]carbamate
dropropizine
Molecular structure of dropropizine
2-(3-methylphenoxy)propanoic acid 2-isopropyl hydrazide
Molecular structure of 2-(3-methylphenoxy)propanoic acid 2-isopropyl hydrazide
2-methyl-2-phenoxypropanoic acid 2-(1-methylethyl) hydrazide
Molecular structure of 2-methyl-2-phenoxypropanoic acid 2-(1-methylethyl) hydrazide
novocain
Molecular structure of novocain
procaine
Molecular structure of procaine