bis(2-methylpropyl) carbonate


bis(2-methylpropyl) carbonate; carbonic acid diisobutyl ester; diisobutyl carbonate; isobutyl carbonate
Links:📏 NIST
CAS:[539-92-4]
Formula:C9H18O3; 174.24 g/mol
InChiKey:UXXXZMDJQLPQPH-UHFFFAOYSA-N
SMILES:CC(C)COC(=O)OCC(C)C
Molecular structure of bis(2-methylpropyl) carbonate
Density:0.914 g/mL
Molar volume:190.6 mL/mol
Refractive index:1.407
Molecular refractive power:46.93 mL/mol
Boiling point:188 °C
Surface tension:25.81 dyn/cm

Isomers

bis(2-methylpropyl) carbonate
Molecular structure of bis(2-methylpropyl) carbonate
tert-butyl 2,2-dimethylpropaneperoxoate
Molecular structure of tert-butyl 2,2-dimethylpropaneperoxoate
butyl 3-ethoxypropanoate
Molecular structure of butyl 3-ethoxypropanoate
2-butyl-2-methyl-1,3-dioxolane-4-methanol
Molecular structure of 2-butyl-2-methyl-1,3-dioxolane-4-methanol
dibutyl carbonate
Molecular structure of dibutyl carbonate
3-(2-ethylbutoxy)propionic acid
Molecular structure of 3-(2-ethylbutoxy)propionic acid
ethyl hexyl carbonate
Molecular structure of ethyl hexyl carbonate
hexyl 2-hydroxypropanoate
Molecular structure of hexyl 2-hydroxypropanoate
2-isobutyl-2-methyl-1,3-dioxolane-4-methanol
Molecular structure of 2-isobutyl-2-methyl-1,3-dioxolane-4-methanol
(2-pentan-3-yl-1,3-dioxolan-4-yl)methanol
Molecular structure of (2-pentan-3-yl-1,3-dioxolan-4-yl)methanol
pentyl 3-methoxypropionate
Molecular structure of pentyl 3-methoxypropionate
2-propoxypropyl propanoate
Molecular structure of 2-propoxypropyl propanoate
propyl 3-propoxypropanoate
Molecular structure of propyl 3-propoxypropanoate