6-hydroxy-2-benzoxazolinone


6-hydroxy-2-benzoxazolinone
CAS:[78213-03-3]
Formula:C7H5NO3; 151.12 g/mol
InChiKey:XIYXDPMPFOQCFW-UHFFFAOYSA-N
SMILES:Oc1ccc2NC(=O)Oc2c1
Molecular structure of 6-hydroxy-2-benzoxazolinone
Melting point:300 °C

Isomers

6-hydroxy-2-benzoxazolinone
Molecular structure of 6-hydroxy-2-benzoxazolinone
2-nitrobenzaldehyde
Molecular structure of 2-nitrobenzaldehyde
3-nitrobenzaldehyde
Molecular structure of 3-nitrobenzaldehyde
4-nitrobenzaldehyde
Molecular structure of 4-nitrobenzaldehyde