4-nitrobenzaldehyde


p-nitrobenzaldehyde; 4-nitrobenzaldehyde
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[555-16-8]
Formula:C7H5NO3; 151.12 g/mol
InChiKey:BXRFQSNOROATLV-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1ccc(C=O)cc1
Molecular structure of 4-nitrobenzaldehyde
Dipole moment:2.65 D
Melting point:106 °C
Log10 partition octanol / water:1.56

Isomers

6-hydroxy-2-benzoxazolinone
Molecular structure of 6-hydroxy-2-benzoxazolinone
2-nitrobenzaldehyde
Molecular structure of 2-nitrobenzaldehyde
3-nitrobenzaldehyde
Molecular structure of 3-nitrobenzaldehyde
4-nitrobenzaldehyde
Molecular structure of 4-nitrobenzaldehyde