3,9-diethyl-6-tridecanol


3,9-diethyl-6-tridecanol
Links:🕷 ChemSpider
CAS:[123-24-0]
Formula:C17H36O; 256.47 g/mol
InChiKey:NWDHHLKROQOLMQ-UHFFFAOYSA-N
SMILES:CCCCC(CC)CCC(O)CCC(CC)CC
Molecular structure of 3,9-diethyl-6-tridecanol
Density:0.842 g/mL
Molar volume:304.6 mL/mol
Boiling point:309 °C

Isomers

3,9-diethyl-6-tridecanol
Molecular structure of 3,9-diethyl-6-tridecanol
3,3-dimethyl-4-pentadecanol
Molecular structure of 3,3-dimethyl-4-pentadecanol
1-heptadecanol
Molecular structure of 1-heptadecanol
2-heptadecanol
Molecular structure of 2-heptadecanol
9-heptadecanol
Molecular structure of 9-heptadecanol
14-methyl-1-hexadecanol
Molecular structure of 14-methyl-1-hexadecanol