2-phenylpent-4-enoic acid


2-phenylpent-4-enoic acid
Links:
📖Houben-Weyl, 2. Band (Phenylallylessigsäure); p. 855,
Formula:C11H12O2; 176.22 g/mol
InChiKey:IQZLXJUYCRPXRG-UHFFFAOYSA-N
SMILES:OC(=O)C(CC=C)c1ccccc1
Molecular structure of 2-phenylpent-4-enoic acid

Isomers

1-acetoxy-2-phenylpropene
Molecular structure of 1-acetoxy-2-phenylpropene
2-(2-acetoxyphenyl)propene
Molecular structure of 2-(2-acetoxyphenyl)propene
2-(3-acetoxyphenyl)propene
Molecular structure of 2-(3-acetoxyphenyl)propene
3'-allyl-4'-hydroxyacetophenone
Molecular structure of 3'-allyl-4'-hydroxyacetophenone
benzyl methacrylate
Molecular structure of benzyl methacrylate
cyclopropyl-(4-methoxyphenyl)methanone
Molecular structure of cyclopropyl-(4-methoxyphenyl)methanone
2,5-dimethyl-7-hydroxy-1-indanone
Molecular structure of 2,5-dimethyl-7-hydroxy-1-indanone
(E)-3-(2,5-dimethylphenyl)prop-2-enoic acid
Molecular structure of (E)-3-(2,5-dimethylphenyl)prop-2-enoic acid
3-ethyl-3-methyl-2-benzofuran-1-one
Molecular structure of 3-ethyl-3-methyl-2-benzofuran-1-one
ethyl 2-phenylprop-2-enoate
Molecular structure of ethyl 2-phenylprop-2-enoate
ethyl (E)-3-phenylprop-2-enoate
Molecular structure of ethyl (E)-3-phenylprop-2-enoate
ethyl (Z)-3-phenyl-2-propenoate
Molecular structure of ethyl (Z)-3-phenyl-2-propenoate
(1E)-1-hydroxy-5-phenylpent-1-en-3-one
Molecular structure of (1E)-1-hydroxy-5-phenylpent-1-en-3-one
2-indanylacetic acid
Molecular structure of 2-indanylacetic acid
6-methoxy-3,4-dihydro-1H-naphthalen-2-one
Molecular structure of 6-methoxy-3,4-dihydro-1H-naphthalen-2-one
6-methoxy-3,4-dihydro-2H-naphthalen-1-one
Molecular structure of 6-methoxy-3,4-dihydro-2H-naphthalen-1-one
3-methoxy-2,4-dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-one
Molecular structure of 3-methoxy-2,4-dimethylbicyclo[4.2.0]octa-1,3,5-trien-7-one
(E)-1-(4-methoxyphenyl)-2-buten-1-one
Molecular structure of (E)-1-(4-methoxyphenyl)-2-buten-1-one
(E)-4-(2-methoxyphenyl)-3-buten-2-one
Molecular structure of (E)-4-(2-methoxyphenyl)-3-buten-2-one
(Z)-4-methoxy-4-phenyl-3-buten-2-one
Molecular structure of (Z)-4-methoxy-4-phenyl-3-buten-2-one
5-methoxy-1-tetralone
Molecular structure of 5-methoxy-1-tetralone
5-methoxy-2-tetralone
Molecular structure of 5-methoxy-2-tetralone
7-methoxy-1-tetralone
Molecular structure of 7-methoxy-1-tetralone
7-methoxy-2-tetralone
Molecular structure of 7-methoxy-2-tetralone
8-methoxy-2-tetralone
Molecular structure of 8-methoxy-2-tetralone
2-methyl-6-methoxy-1-indanone
Molecular structure of 2-methyl-6-methoxy-1-indanone
methyl (Z)-2-methyl-3-phenyl-2-propenoate
Molecular structure of methyl (Z)-2-methyl-3-phenyl-2-propenoate
methyl (2Z)-3-methyl-3-phenyl-2-propenoate
Molecular structure of methyl (2Z)-3-methyl-3-phenyl-2-propenoate
methyl (E)-3-methyl-3-phenyl-2-propenoate
Molecular structure of methyl (E)-3-methyl-3-phenyl-2-propenoate
methyl (E)-3-(4-methylphenyl)-2-propenoate
Molecular structure of methyl (E)-3-(4-methylphenyl)-2-propenoate
2-methyl-1-phenylbutane-1,3-dione
Molecular structure of 2-methyl-1-phenylbutane-1,3-dione
(2E)-3-(4-methylphenyl)but-2-enoic acid
Molecular structure of (2E)-3-(4-methylphenyl)but-2-enoic acid
1-phenylpentane-1,3-dione
Molecular structure of 1-phenylpentane-1,3-dione
1-phenylpentane-1,4-dione
Molecular structure of 1-phenylpentane-1,4-dione
2-phenylpent-4-enoic acid
Molecular structure of 2-phenylpent-4-enoic acid
[(E)-3-phenylprop-2-enyl] acetate
Molecular structure of [(E)-3-phenylprop-2-enyl] acetate
3-propan-2-yl-3H-2-benzofuran-1-one
Molecular structure of 3-propan-2-yl-3H-2-benzofuran-1-one
1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
Molecular structure of 1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
5,6,7,8-tetrahydronaphthalene-1-carboxylic acid
Molecular structure of 5,6,7,8-tetrahydronaphthalene-1-carboxylic acid
5,6,7,8-tetrahydronaphthalene-2-carboxylic acid
Molecular structure of 5,6,7,8-tetrahydronaphthalene-2-carboxylic acid