2,6-diisopropylaniline


2,6-bis(1-methylethyl)benzenamine; 2,6-diisopropylaniline
Links:📏 NIST, 📖 PubMed
CAS:[24544-04-5]
Formula:C12H19N; 177.29 g/mol
InChiKey:WKBALTUBRZPIPZ-UHFFFAOYSA-N
SMILES:CC(C)c1cccc(C(C)C)c1N
Molecular structure of 2,6-diisopropylaniline
Density:0.940 g/mL
Molar volume:188.6 mL/mol
Refractive index:1.533
Molecular refractive power:58.54 mL/mol
Melting point:-54 °C
Boiling point:257 °C
Log10 partition octanol / water:3.18

Isomers

N-tert-butyl-3,5-dimethylaniline
Molecular structure of N-tert-butyl-3,5-dimethylaniline
4-tert-butyl-N,N-dimethylaniline
Molecular structure of 4-tert-butyl-N,N-dimethylaniline
N,N-diisopropylaniline
Molecular structure of N,N-diisopropylaniline
2,6-diisopropylaniline
Molecular structure of 2,6-diisopropylaniline
N,N-dipropylaniline
Molecular structure of N,N-dipropylaniline
2-heptylpyridine
Molecular structure of 2-heptylpyridine
3-heptylpyridine
Molecular structure of 3-heptylpyridine
4-heptylpyridine
Molecular structure of 4-heptylpyridine
N-hexylaniline
Molecular structure of N-hexylaniline
4-hexylaniline
Molecular structure of 4-hexylaniline
isopropylamphetamine
Molecular structure of isopropylamphetamine
1-phenyl-2-amino-3,3-dimethylbutane
Molecular structure of 1-phenyl-2-amino-3,3-dimethylbutane
1-phenyl-2-aminohexane
Molecular structure of 1-phenyl-2-aminohexane
1-phenyl-2-amino-4-methylpentane
Molecular structure of 1-phenyl-2-amino-4-methylpentane
1-phenyl-N-propylpropan-2-amine
Molecular structure of 1-phenyl-N-propylpropan-2-amine
4-(1-propylbutyl)pyridine
Molecular structure of 4-(1-propylbutyl)pyridine
1-(3,4,5-trimethylphenyl)-2-aminopropane
Molecular structure of 1-(3,4,5-trimethylphenyl)-2-aminopropane