[2-(2-hydroxyethyl-methylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)propanoate


[2-(2-hydroxyethyl-methylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)propanoate; 6-methoxy-α-methyl-2-naphthaleneacetic acid 2-[(2-hydroxyethyl)methylamino]-2-oxoethyl ester; naproxen [N-(2-hydroxyethyl)-N-methyl-carbamoyl]methyl ester
CAS:[114665-19-9]
Formula:C19H23NO5; 345.40 g/mol
InChiKey:UKUHRIHGVXNNCI-UHFFFAOYSA-N
SMILES:COc1ccc2cc(ccc2c1)C(C)C(=O)OCC(=O)N(C)CCO
Molecular structure of [2-(2-hydroxyethyl-methylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)propanoate

Isomers

1-tert-butoxycarbonyl-2-oxo-4-(5-ethoxybenzofur-2-yl)pyrrolidine
Molecular structure of 1-tert-butoxycarbonyl-2-oxo-4-(5-ethoxybenzofur-2-yl)pyrrolidine
(2-(2',6'-dimethoxy)phenoxyethylamino)methylbenzo-1,4-dioxane
Molecular structure of (2-(2',6'-dimethoxy)phenoxyethylamino)methylbenzo-1,4-dioxane
2-[2-hydroxyethyl(methyl)amino]-2-oxoethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate
Molecular structure of 2-[2-hydroxyethyl(methyl)amino]-2-oxoethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate
[2-(2-hydroxyethyl-methylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)propanoate
Molecular structure of [2-(2-hydroxyethyl-methylamino)-2-oxoethyl] 2-(6-methoxynaphthalen-2-yl)propanoate
morphine acetate
Molecular structure of morphine acetate
tretoquinol
Molecular structure of tretoquinol