(S,S)-(-)-1,4-dimethoxy-2,3-butanediol


(S,S)-(-)-1,4-dimethoxy-2,3-butanediol
CAS:[50622-10-1]
Formula:C6H14O4; 150.17 g/mol
InChiKey:QPXJVYUZWDGUBO-WDSKDSINSA-N
SMILES:COC[C@H](O)[C@@H](O)COC
Molecular structure of (S,S)-(-)-1,4-dimethoxy-2,3-butanediol
Melting point:29 °C

Isomers

(R,R)-(+)-1,4-dimethoxy-2,3-butanediol
Molecular structure of (R,R)-(+)-1,4-dimethoxy-2,3-butanediol
(S,S)-(-)-1,4-dimethoxy-2,3-butanediol
Molecular structure of (S,S)-(-)-1,4-dimethoxy-2,3-butanediol
triethylene glycol
Molecular structure of triethylene glycol