(3R,4R)-3,4-dihydroxyoxolan-2-one


(3R,4R)-3,4-dihydroxyoxolan-2-one; D-erythronic acid γ-lactone; D-erythrono-1,4-lactone
CAS:[15667-21-7]
Formula:C4H6O4; 118.09 g/mol
InChiKey:SGMJBNSHAZVGMC-PWNYCUMCSA-N
SMILES:O[C@@H]1COC(=O)[C@@H]1O
Molecular structure of (3R,4R)-3,4-dihydroxyoxolan-2-one
Melting point:101 °C

Isomers

acetoxyacetic acid
Molecular structure of acetoxyacetic acid
diacetyl peroxide
Molecular structure of diacetyl peroxide
1,2-diformyloxyethane
Molecular structure of 1,2-diformyloxyethane
(3R,4R)-3,4-dihydroxyoxolan-2-one
Molecular structure of (3R,4R)-3,4-dihydroxyoxolan-2-one
ethyl hydrogen oxalate
Molecular structure of ethyl hydrogen oxalate
4-(hydroxymethyl)-1,3-dioxolan-2-one
Molecular structure of 4-(hydroxymethyl)-1,3-dioxolan-2-one
methyl hydrogen malonate
Molecular structure of methyl hydrogen malonate
methylpropanedioic acid
Molecular structure of methylpropanedioic acid
succinic acid
Molecular structure of succinic acid