(+-)-cis-bicyclo[3.2.0]hept-2-en-6-one


(±)-cis-bicyclo[3.2.0]hept-2-en-6-one
Formula:C7H8O; 108.14 g/mol
InChiKey:LNLLHUHPGPKRBM-PHDIDXHHSA-N
SMILES:O=C1C[C@H]2C=CC[C@@H]12
Molecular structure of (+-)-cis-bicyclo[3.2.0]hept-2-en-6-one
Boiling point:159 °C

Isomers

benzyl alcohol
Molecular structure of benzyl alcohol
(±)-cis-bicyclo[3.2.0]hept-2-en-6-one
Molecular structure of (+-)-cis-bicyclo[3.2.0]hept-2-en-6-one
methoxybenzene
Molecular structure of methoxybenzene
2-methylphenol
Molecular structure of 2-methylphenol
3-methylphenol
Molecular structure of 3-methylphenol
4-methylphenol
Molecular structure of 4-methylphenol